ChemNet > CAS > 94232-28-7 L-glutamic acid, compound with 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine (1:1)
94232-28-7 L-glutamic acid, compound with 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine (1:1)
| product Name |
L-glutamic acid, compound with 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine (1:1) |
| CAS No |
94232-28-7 |
| Synonyms |
L-Glutamic acid, compound with 5-((3,4,5-trimethoxyphenyl)methyl)pyrimidine-2,4-diamine (1:1); (2S)-2-aminopentanedioic acid; 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| Molecular Formula |
C19H27N5O7 |
| Molecular Weight |
437.447 |
| InChI |
InChI=1/C14H18N4O3.C5H9NO4/c1-19-10-5-8(6-11(20-2)12(10)21-3)4-9-7-17-14(16)18-13(9)15;6-3(5(9)10)1-2-4(7)8/h5-7H,4H2,1-3H3,(H4,15,16,17,18);3H,1-2,6H2,(H,7,8)(H,9,10)/t;3-/m.0/s1 |
| EINECS |
303-954-9 |
| Molecular Structure |
![94232-28-7 L-glutamic acid, compound with 5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine (1:1)](https://images-a.chemnet.com/suppliers/chembase/cas5/cas94232-28-7.gif)
|
| Boiling point |
725.2°C at 760 mmHg |
| Flash point |
392.4°C |
| Vapour Pressur |
4.48E-22mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
